"2-Pyrrolidinone, 1-ethenyl-" |
|
|
|
"Vinyl(N-)-pyrrolidone(2-)" |
|
|
1-ethenylpyrrolidin-2-one (2-Pyrrolidione, 1-ethenyl-) |
|
1-ethenylpyrrolidin-2-one(2-Pyrrolidione, 1-ethenyl-) |
|
|
1-Vinyl-2-pyrrolidinone, monomer |
|
|
|
1-vinyl-tetrahydropyrrol-2-one[Sheftel |
|
|
|
1-vinylpyrrolidinone[IARC. Monographs on the Evaluation of the Carcinogenic Risk of Chemicals to Man. Geneva: World Health Organization |
|
|
2-Pyrrolidinone, 1-ethenyl- |
|
2-Pyrrolidinone, 1-vinyl- |
|
2-PYRROLIDINONE,1-ETHENYL- |
|
|
|
|
InChI=1/C6H9NO/c1-2-7-5-3-4-6(7)8/h2H,1,3-5H |
|
|
|
N-vinyl-2-pyrrolidinone[IARC. Monographs on the Evaluation of the Carcinogenic Risk of Chemicals to Man. Geneva: World Health Organization |
|
|
N-Vinyl-2-pyrrolidone and Polyvinyl Pyrrolidone |
|
N-vinyl-2-pyrrolidone[IARC. Monographs on the Evaluation of the Carcinogenic Risk of Chemicals to Man. Geneva: World Health Organization |
|
|
N-vinylbutyrolactam[Sheftel |
|
|
|
|
N-vinylpyrrolidone[Verschueren |
|
|
|
NVP[Ullmann's Encyclopedia of Industrial Chemistry. 6th ed.Vol 1: Federal Republic of Germany: Wiley-VCH Verlag GmbH & Co. 2003 to Present |
|
PolyVinyl Pyridine N-Oxide |
|
|
|
|
|
|
|
|
|
|
|
|