 |
|
aniline mustard
An alkylating mustard with antineoplastic activity. Aniline mustard forms covalent linkages with nucleophilic centers, resulting in depurination, base miscoding and strand scission, and crosslinking of DNA strands, all of which contribute to its cytotoxicity. Check for active clinical trials or closed clinical trials using this agent. (NCI Thesaurus)
| Synonyms: | | lymphochin
lymphocin
lymphoquin
mesylerythrol | | | | Code names: | | A 14489
CB 1074
SK 592
TL 476 | | | | Chemical structure names: | | - benzenamine, N, N-bis(2-chloroethyl)-(9CI)
- beta, beta'-dichlorodiethylaniline
- N,N-bis(2-chloroethyl)aniline
- N,N-bis(2-chloroethyl)benzenamine
- phenylbis[2-chloroethylamine]
| | |
|
|
