|
|
aniline mustard An alkylating mustard with antineoplastic activity. Aniline mustard forms covalent linkages with nucleophilic centers, resulting in depurination, base miscoding and strand scission, and crosslinking of DNA strands, all of which contribute to its cytotoxicity. Check for active clinical trials or closed clinical trials using this agent. (NCI Thesaurus)
Synonyms: | | lymphochin lymphocin lymphoquin mesylerythrol | | | Code names: | | A 14489 CB 1074 SK 592 TL 476 | | | Chemical structure names: | | - benzenamine, N, N-bis(2-chloroethyl)-(9CI)
- beta, beta'-dichlorodiethylaniline
- N,N-bis(2-chloroethyl)aniline
- N,N-bis(2-chloroethyl)benzenamine
- phenylbis[2-chloroethylamine]
| | |
|
|